C20H32 — CID 171666172
(1R,2Z,6Z,10S,11R)-3,7,11-trimethyl-11-(4-methylpent-3-enyl)bicyclo[8.1.0]undeca-2,6-diene (PubChem CID 171666172) has the molecular formula C20H32 and a molecular weight of 272.48 g/mol. Its IUPAC name is (1R,2Z,6Z,10S,11R)-3,7,11-trimethyl-11-(4-methylpent-3-enyl)bicyclo[8.1.0]undeca-2,6-diene.
| Compound Name | (1R,2Z,6Z,10S,11R)-3,7,11-trimethyl-11-(4-methylpent-3-enyl)bicyclo[8.1.0]undeca-2,6-diene |
|---|---|
| PubChem CID | 171666172 |
| Molecular Formula | C20H32 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | (1R,2Z,6Z,10S,11R)-3,7,11-trimethyl-11-(4-methylpent-3-enyl)bicyclo[8.1.0]undeca-2,6-diene |
| SMILES | CC(C)=CCC[C@@]1(C)[C@@H]2/C=C(/C)CC/C=C(/C)CC[C@@H]21 |
| InChI | InChI=1S/C20H32/c1-15(2)8-7-13-20(5)18-12-11-16(3)9-6-10-17(4)14-19(18)20/h8-9,14,18-19H,6-7,10-13H2,1-5H3/b16-9-,17-14-/t18-,19+,20+/m0/s1 |
| InChIKey | KYKXKNMWODEXOJ-GGAMFQQQSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|