C22H32O4 — CID 23247440
[(1S,3R,4S,5E,8Z,10S,11R)-4-hydroxy-4,8,11-trimethyl-11-(4-methylpent-3-enyl)-7-oxo-3-bicyclo[8.1.0]undeca-5,8-dienyl] acetate (PubChem CID 23247440) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(1S,3R,4S,5E,8Z,10S,11R)-4-hydroxy-4,8,11-trimethyl-11-(4-methylpent-3-enyl)-7-oxo-3-bicyclo[8.1.0]undeca-5,8-dienyl] acetate.
| Compound Name | [(1S,3R,4S,5E,8Z,10S,11R)-4-hydroxy-4,8,11-trimethyl-11-(4-methylpent-3-enyl)-7-oxo-3-bicyclo[8.1.0]undeca-5,8-dienyl] acetate |
|---|---|
| PubChem CID | 23247440 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(1S,3R,4S,5E,8Z,10S,11R)-4-hydroxy-4,8,11-trimethyl-11-(4-methylpent-3-enyl)-7-oxo-3-bicyclo[8.1.0]undeca-5,8-dienyl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H]2[C@H](/C=C(/C)C(=O)/C=C/[C@]1(C)O)[C@]2(C)CCC=C(C)C |
| InChI | InChI=1S/C22H32O4/c1-14(2)8-7-10-21(5)17-12-15(3)19(24)9-11-22(6,25)20(13-18(17)21)26-16(4)23/h8-9,11-12,17-18,20,25H,7,10,13H2,1-6H3/b11-9+,15-12-/t17-,18-,20+,21-,22-/m0/s1 |
| InChIKey | PXISSXSNRLLQOK-UKNZKKBLSA-N |
| XLogP | 4.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|