C24H36O4 — CID 162964587
[1-acetyloxy-2,8-dimethyl-5-(6-methylhepta-2,5-dien-2-yl)-3-tricyclo[5.3.0.02,6]decanyl] acetate (PubChem CID 162964587) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is [1-acetyloxy-2,8-dimethyl-5-(6-methylhepta-2,5-dien-2-yl)-3-tricyclo[5.3.0.02,6]decanyl] acetate.
| Compound Name | [1-acetyloxy-2,8-dimethyl-5-(6-methylhepta-2,5-dien-2-yl)-3-tricyclo[5.3.0.02,6]decanyl] acetate |
|---|---|
| PubChem CID | 162964587 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | [1-acetyloxy-2,8-dimethyl-5-(6-methylhepta-2,5-dien-2-yl)-3-tricyclo[5.3.0.02,6]decanyl] acetate |
| SMILES | CC(=O)OC1CC(C(C)=CCC=C(C)C)C2C3C(C)CCC3(OC(C)=O)C12C |
| InChI | InChI=1S/C24H36O4/c1-14(2)9-8-10-15(3)19-13-20(27-17(5)25)23(7)22(19)21-16(4)11-12-24(21,23)28-18(6)26/h9-10,16,19-22H,8,11-13H2,1-7H3 |
| InChIKey | ULLROVGWICSZTK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|