C15H26O4 — CID 10923616
(1R,2S,3S,4R)-4-(hydroxymethyl)-3-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexane-1,2,4-triol (PubChem CID 10923616) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (1R,2S,3S,4R)-4-(hydroxymethyl)-3-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexane-1,2,4-triol.
| Compound Name | (1R,2S,3S,4R)-4-(hydroxymethyl)-3-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexane-1,2,4-triol |
|---|---|
| PubChem CID | 10923616 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (1R,2S,3S,4R)-4-(hydroxymethyl)-3-[(2E)-6-methylhepta-2,5-dien-2-yl]cyclohexane-1,2,4-triol |
| SMILES | CC(C)=CC/C=C(\C)[C@H]1[C@H](O)[C@H](O)CC[C@]1(O)CO |
| InChI | InChI=1S/C15H26O4/c1-10(2)5-4-6-11(3)13-14(18)12(17)7-8-15(13,19)9-16/h5-6,12-14,16-19H,4,7-9H2,1-3H3/b11-6+/t12-,13+,14-,15+/m1/s1 |
| InChIKey | MUVKMFBDLJUSSN-UYTUHJIOSA-N |
| XLogP | 1.14 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|