C9H16O3 — CID 11062866
[(1R,2R)-2-hydroxy-1-methylcyclohexyl] acetate (PubChem CID 11062866) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is [(1R,2R)-2-hydroxy-1-methylcyclohexyl] acetate.
| Compound Name | [(1R,2R)-2-hydroxy-1-methylcyclohexyl] acetate |
|---|---|
| PubChem CID | 11062866 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | [(1R,2R)-2-hydroxy-1-methylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@]1(C)CCCC[C@H]1O |
| InChI | InChI=1S/C9H16O3/c1-7(10)12-9(2)6-4-3-5-8(9)11/h8,11H,3-6H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | NMBFPZKMGWEHMM-RKDXNWHRSA-N |
| XLogP | 1.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |