C8H14O3 — CID 130753130
1-[(1R,2R)-1,2-dihydroxycyclohexyl]ethanone (PubChem CID 130753130) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is 1-[(1R,2R)-1,2-dihydroxycyclohexyl]ethanone.
| Compound Name | 1-[(1R,2R)-1,2-dihydroxycyclohexyl]ethanone |
|---|---|
| PubChem CID | 130753130 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 1-[(1R,2R)-1,2-dihydroxycyclohexyl]ethanone |
| SMILES | CC(=O)[C@@]1(O)CCCC[C@H]1O |
| InChI | InChI=1S/C8H14O3/c1-6(9)8(11)5-3-2-4-7(8)10/h7,10-11H,2-5H2,1H3/t7-,8+/m1/s1 |
| InChIKey | XCXITQLIWIIHFX-SFYZADRCSA-N |
| XLogP | 0.24 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |