C7H12O3 — CID 45083540
trans-(1R,2R)-1,2-dihydroxycyclohexane-1-carbaldehyde (PubChem CID 45083540) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is trans-(1R,2R)-1,2-dihydroxycyclohexane-1-carbaldehyde.
| Compound Name | trans-(1R,2R)-1,2-dihydroxycyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 45083540 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | trans-(1R,2R)-1,2-dihydroxycyclohexane-1-carbaldehyde |
| SMILES | O=C[C@@]1(O)CCCC[C@H]1O |
| InChI | InChI=1S/C7H12O3/c8-5-7(10)4-2-1-3-6(7)9/h5-6,9-10H,1-4H2/t6-,7+/m1/s1 |
| InChIKey | PFEGFQOIUVWRIW-RQJHMYQMSA-N |
| XLogP | -0.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|