About (4S,5R)-spiro[4.5]decane-4,10-diol
(4S,5R)-spiro[4.5]decane-4,10-diol (PubChem CID 135069767) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (4S,5R)-spiro[4.5]decane-4,10-diol.
Molecular Properties
| Compound Name | (4S,5R)-spiro[4.5]decane-4,10-diol |
| PubChem CID | 135069767 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (4S,5R)-spiro[4.5]decane-4,10-diol |
| SMILES | OC1CCCC[C@]12CCC[C@@H]2O |
| InChI | InChI=1S/C10H18O2/c11-8-4-1-2-6-10(8)7-3-5-9(10)12/h8-9,11-12H,1-7H2/t8?,9-,10-/m0/s1 |
| InChIKey | MPHQTUMHVASIGO-AGROOBSYSA-N |
| XLogP | 1.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S,5R)-spiro[4.5]decane-4,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5R)-spiro[4.5]decane-4,10-diol?
The IUPAC name of (4S,5R)-spiro[4.5]decane-4,10-diol (CID 135069767) is (4S,5R)-spiro[4.5]decane-4,10-diol.
What is the SMILES notation for (4S,5R)-spiro[4.5]decane-4,10-diol?
The canonical SMILES for (4S,5R)-spiro[4.5]decane-4,10-diol is OC1CCCC[C@]12CCC[C@@H]2O.
What is the InChIKey of (4S,5R)-spiro[4.5]decane-4,10-diol?
The InChIKey is MPHQTUMHVASIGO-AGROOBSYSA-N. The full InChI is InChI=1S/C10H18O2/c11-8-4-1-2-6-10(8)7-3-5-9(10)12/h8-9,11-12H,1-7H2/t8?,9-,10-/m0/s1.
What are the key properties of (4S,5R)-spiro[4.5]decane-4,10-diol?
(4S,5R)-spiro[4.5]decane-4,10-diol has a molecular weight of 170.25 g/mol, XLogP of 1.45, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5R)-spiro[4.5]decane-4,10-diol is sourced from PubChem (CID 135069767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).