About spiro[4.5]decan-4-ol;dihydrochloride
spiro[4.5]decan-4-ol;dihydrochloride (PubChem CID 141041320) has the molecular formula C10H20Cl2O
and a molecular weight of 227.17 g/mol. Its IUPAC name is spiro[4.5]decan-4-ol;dihydrochloride.
Molecular Properties
| Compound Name | spiro[4.5]decan-4-ol;dihydrochloride |
| PubChem CID | 141041320 |
| Molecular Formula | C10H20Cl2O |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | spiro[4.5]decan-4-ol;dihydrochloride |
| SMILES | Cl.Cl.OC1CCCC12CCCCC2 |
| InChI | InChI=1S/C10H18O.2ClH/c11-9-5-4-8-10(9)6-2-1-3-7-10;;/h9,11H,1-8H2;2*1H |
| InChIKey | UXPSDZCHJHKSLF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[4.5]decan-4-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[4.5]decan-4-ol;dihydrochloride?
The IUPAC name of spiro[4.5]decan-4-ol;dihydrochloride (CID 141041320) is spiro[4.5]decan-4-ol;dihydrochloride.
What is the SMILES notation for spiro[4.5]decan-4-ol;dihydrochloride?
The canonical SMILES for spiro[4.5]decan-4-ol;dihydrochloride is Cl.Cl.OC1CCCC12CCCCC2.
What is the InChIKey of spiro[4.5]decan-4-ol;dihydrochloride?
The InChIKey is UXPSDZCHJHKSLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O.2ClH/c11-9-5-4-8-10(9)6-2-1-3-7-10;;/h9,11H,1-8H2;2*1H.
What are the key properties of spiro[4.5]decan-4-ol;dihydrochloride?
spiro[4.5]decan-4-ol;dihydrochloride has a molecular weight of 227.17 g/mol, XLogP of 3.33, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[4.5]decan-4-ol;dihydrochloride is sourced from PubChem (CID 141041320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).