About spiro[3.5]nonane-3,7-diol
spiro[3.5]nonane-3,7-diol (PubChem CID 139886993) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is spiro[3.5]nonane-3,7-diol.
Molecular Properties
| Compound Name | spiro[3.5]nonane-3,7-diol |
| PubChem CID | 139886993 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | spiro[3.5]nonane-3,7-diol |
| SMILES | OC1CCC2(CC1)CCC2O |
| InChI | InChI=1S/C9H16O2/c10-7-1-4-9(5-2-7)6-3-8(9)11/h7-8,10-11H,1-6H2 |
| InChIKey | WMVJAEHLPHBMCE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[3.5]nonane-3,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3.5]nonane-3,7-diol?
The IUPAC name of spiro[3.5]nonane-3,7-diol (CID 139886993) is spiro[3.5]nonane-3,7-diol.
What is the SMILES notation for spiro[3.5]nonane-3,7-diol?
The canonical SMILES for spiro[3.5]nonane-3,7-diol is OC1CCC2(CC1)CCC2O.
What is the InChIKey of spiro[3.5]nonane-3,7-diol?
The InChIKey is WMVJAEHLPHBMCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c10-7-1-4-9(5-2-7)6-3-8(9)11/h7-8,10-11H,1-6H2.
What are the key properties of spiro[3.5]nonane-3,7-diol?
spiro[3.5]nonane-3,7-diol has a molecular weight of 156.22 g/mol, XLogP of 1.06, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3.5]nonane-3,7-diol is sourced from PubChem (CID 139886993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).