C5H10O2 — CID 130694777
(2R)-1-methylcyclobutane-1,2-diol (PubChem CID 130694777) has the molecular formula C5H10O2 and a molecular weight of 102.13 g/mol. Its IUPAC name is (2R)-1-methylcyclobutane-1,2-diol.
| Compound Name | (2R)-1-methylcyclobutane-1,2-diol |
|---|---|
| PubChem CID | 130694777 |
| Molecular Formula | C5H10O2 |
| Molecular Weight | 102.13 g/mol |
| Exact Mass | 102.07 |
| IUPAC Name | (2R)-1-methylcyclobutane-1,2-diol |
| SMILES | CC1(O)CC[C@H]1O |
| InChI | InChI=1S/C5H10O2/c1-5(7)3-2-4(5)6/h4,6-7H,2-3H2,1H3/t4-,5?/m1/s1 |
| InChIKey | AUIKLSXVOASOKC-CNZKWPKMSA-N |
| XLogP | -0.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.13 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |