C12H20O2 — CID 10488138
(1R,4S,4aR,8aR)-4,8a-dimethyl-1,2,3,4a,7,8-hexahydronaphthalene-1,4-diol (PubChem CID 10488138) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (1R,4S,4aR,8aR)-4,8a-dimethyl-1,2,3,4a,7,8-hexahydronaphthalene-1,4-diol.
| Compound Name | (1R,4S,4aR,8aR)-4,8a-dimethyl-1,2,3,4a,7,8-hexahydronaphthalene-1,4-diol |
|---|---|
| PubChem CID | 10488138 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (1R,4S,4aR,8aR)-4,8a-dimethyl-1,2,3,4a,7,8-hexahydronaphthalene-1,4-diol |
| SMILES | C[C@@]12CCC=C[C@H]1[C@@](C)(O)CC[C@H]2O |
| InChI | InChI=1S/C12H20O2/c1-11-7-4-3-5-9(11)12(2,14)8-6-10(11)13/h3,5,9-10,13-14H,4,6-8H2,1-2H3/t9-,10-,11-,12+/m1/s1 |
| InChIKey | IYDQNCURZPCTDO-KKOKHZNYSA-N |
| XLogP | 1.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|