C8H14O — CID 550886
6,6-dimethylcyclohex-2-en-1-ol (PubChem CID 550886) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is 6,6-dimethylcyclohex-2-en-1-ol.
| Compound Name | 6,6-dimethylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 550886 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | 6,6-dimethylcyclohex-2-en-1-ol |
| SMILES | CC1(C)CCC=CC1O |
| InChI | InChI=1S/C8H14O/c1-8(2)6-4-3-5-7(8)9/h3,5,7,9H,4,6H2,1-2H3 |
| InChIKey | UHRILKRODDSOBA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|