C11H18O3 — CID 159107949
methyl (1S,4E,6S)-6-hydroxy-1-methylcyclooct-4-ene-1-carboxylate (PubChem CID 159107949) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is methyl (1S,4E,6S)-6-hydroxy-1-methylcyclooct-4-ene-1-carboxylate.
| Compound Name | methyl (1S,4E,6S)-6-hydroxy-1-methylcyclooct-4-ene-1-carboxylate |
|---|---|
| PubChem CID | 159107949 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | methyl (1S,4E,6S)-6-hydroxy-1-methylcyclooct-4-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CC/C=C\[C@@H](O)CC1 |
| InChI | InChI=1S/C11H18O3/c1-11(10(13)14-2)7-4-3-5-9(12)6-8-11/h3,5,9,12H,4,6-8H2,1-2H3/b5-3-/t9-,11+/m1/s1 |
| InChIKey | IWSJMRVELULDMG-PMEPJVLUSA-N |
| XLogP | 1.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|