C8H13ClO2 — CID 14435921
trans-methyl (1R,3S)-3-chloro-1-methylcyclopentane-1-carboxylate (PubChem CID 14435921) has the molecular formula C8H13ClO2 and a molecular weight of 176.64 g/mol. Its IUPAC name is trans-methyl (1R,3S)-3-chloro-1-methylcyclopentane-1-carboxylate.
| Compound Name | trans-methyl (1R,3S)-3-chloro-1-methylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 14435921 |
| Molecular Formula | C8H13ClO2 |
| Molecular Weight | 176.64 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | trans-methyl (1R,3S)-3-chloro-1-methylcyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CC[C@H](Cl)C1 |
| InChI | InChI=1S/C8H13ClO2/c1-8(7(10)11-2)4-3-6(9)5-8/h6H,3-5H2,1-2H3/t6-,8+/m0/s1 |
| InChIKey | PGJFNIKLAOXZMG-POYBYMJQSA-N |
| XLogP | 1.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.64 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|