C8H13ClO2 — CID 12547623
4-chloro-1-methylcyclohexane-1-carboxylic acid (PubChem CID 12547623) has the molecular formula C8H13ClO2 and a molecular weight of 176.64 g/mol. Its IUPAC name is 4-chloro-1-methylcyclohexane-1-carboxylic acid.
| Compound Name | 4-chloro-1-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 12547623 |
| Molecular Formula | C8H13ClO2 |
| Molecular Weight | 176.64 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 4-chloro-1-methylcyclohexane-1-carboxylic acid |
| SMILES | CC1(C(=O)O)CCC(Cl)CC1 |
| InChI | InChI=1S/C8H13ClO2/c1-8(7(10)11)4-2-6(9)3-5-8/h6H,2-5H2,1H3,(H,10,11) |
| InChIKey | MJPYVADOTNXODZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.64 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|