C9H14Cl2O2 — CID 12734798
(1R,3R,4R)-3,4-dichloro-1,4-dimethylcyclohexane-1-carboxylic acid (PubChem CID 12734798) has the molecular formula C9H14Cl2O2 and a molecular weight of 225.11 g/mol. Its IUPAC name is (1R,3R,4R)-3,4-dichloro-1,4-dimethylcyclohexane-1-carboxylic acid.
| Compound Name | (1R,3R,4R)-3,4-dichloro-1,4-dimethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 12734798 |
| Molecular Formula | C9H14Cl2O2 |
| Molecular Weight | 225.11 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | (1R,3R,4R)-3,4-dichloro-1,4-dimethylcyclohexane-1-carboxylic acid |
| SMILES | C[C@@]1(C(=O)O)CC[C@@](C)(Cl)[C@H](Cl)C1 |
| InChI | InChI=1S/C9H14Cl2O2/c1-8(7(12)13)3-4-9(2,11)6(10)5-8/h6H,3-5H2,1-2H3,(H,12,13)/t6-,8-,9-/m1/s1 |
| InChIKey | PDTBBETZEJDSAH-FTLITQJKSA-N |
| XLogP | 2.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.11 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|