methyl 4-iodo-1-methylcyclohexane-1-carboxylate

C9H15IO2 — CID 121364070

IUPACmethyl 4-iodo-1-methylcyclohexane-1-carboxylate
SMILESCOC(=O)C1(C)CCC(I)CC1
InChIInChI=1S/C9H15IO2/c1-9(8(11)12-2)5-3-7(10)4-6-9/h7H,3-6H2,1-2H3
InChIKeyUGUBXZORWVKTIA-UHFFFAOYSA-N
MW282.12 g/mol
LogP2.54
Rot. Bonds1

About methyl 4-iodo-1-methylcyclohexane-1-carboxylate

methyl 4-iodo-1-methylcyclohexane-1-carboxylate (PubChem CID 121364070) has the molecular formula C9H15IO2 and a molecular weight of 282.12 g/mol. Its IUPAC name is methyl 4-iodo-1-methylcyclohexane-1-carboxylate.

Molecular Properties

Compound Namemethyl 4-iodo-1-methylcyclohexane-1-carboxylate
PubChem CID121364070
Molecular FormulaC9H15IO2
Molecular Weight282.12 g/mol
Exact Mass282.01
IUPAC Namemethyl 4-iodo-1-methylcyclohexane-1-carboxylate
SMILESCOC(=O)C1(C)CCC(I)CC1
InChIInChI=1S/C9H15IO2/c1-9(8(11)12-2)5-3-7(10)4-6-9/h7H,3-6H2,1-2H3
InChIKeyUGUBXZORWVKTIA-UHFFFAOYSA-N
XLogP2.54
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.12
LogP ≤ 52.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze methyl 4-iodo-1-methylcyclohexane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-iodo-1-methylcyclohexane-1-carboxylate?
The IUPAC name of methyl 4-iodo-1-methylcyclohexane-1-carboxylate (CID 121364070) is methyl 4-iodo-1-methylcyclohexane-1-carboxylate.
What is the SMILES notation for methyl 4-iodo-1-methylcyclohexane-1-carboxylate?
The canonical SMILES for methyl 4-iodo-1-methylcyclohexane-1-carboxylate is COC(=O)C1(C)CCC(I)CC1.
What is the InChIKey of methyl 4-iodo-1-methylcyclohexane-1-carboxylate?
The InChIKey is UGUBXZORWVKTIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15IO2/c1-9(8(11)12-2)5-3-7(10)4-6-9/h7H,3-6H2,1-2H3.
What are the key properties of methyl 4-iodo-1-methylcyclohexane-1-carboxylate?
methyl 4-iodo-1-methylcyclohexane-1-carboxylate has a molecular weight of 282.12 g/mol, XLogP of 2.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-iodo-1-methylcyclohexane-1-carboxylate is sourced from PubChem (CID 121364070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).