About dimethyl 1-methyl-3-propan-2-ylcyclopentane-1,3-dicarboxylate
dimethyl 1-methyl-3-propan-2-ylcyclopentane-1,3-dicarboxylate (PubChem CID 91799029) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is dimethyl 1-methyl-3-propan-2-ylcyclopentane-1,3-dicarboxylate.
Analyze dimethyl 1-methyl-3-propan-2-ylcyclopentane-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 1-methyl-3-propan-2-ylcyclopentane-1,3-dicarboxylate?
The IUPAC name of dimethyl 1-methyl-3-propan-2-ylcyclopentane-1,3-dicarboxylate (CID 91799029) is dimethyl 1-methyl-3-propan-2-ylcyclopentane-1,3-dicarboxylate.
What is the SMILES notation for dimethyl 1-methyl-3-propan-2-ylcyclopentane-1,3-dicarboxylate?
The canonical SMILES for dimethyl 1-methyl-3-propan-2-ylcyclopentane-1,3-dicarboxylate is COC(=O)C1(C)CCC(C(=O)OC)(C(C)C)C1.
What is the InChIKey of dimethyl 1-methyl-3-propan-2-ylcyclopentane-1,3-dicarboxylate?
The InChIKey is DZSWKBZPPVWXQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4/c1-9(2)13(11(15)17-5)7-6-12(3,8-13)10(14)16-4/h9H,6-8H2,1-5H3.
What are the key properties of dimethyl 1-methyl-3-propan-2-ylcyclopentane-1,3-dicarboxylate?
dimethyl 1-methyl-3-propan-2-ylcyclopentane-1,3-dicarboxylate has a molecular weight of 242.31 g/mol, XLogP of 2.16, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1-methyl-3-propan-2-ylcyclopentane-1,3-dicarboxylate is sourced from PubChem (CID 91799029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).