C12H22O2 — CID 11127251
(4S,5R,12R)-spiro[4.7]dodecane-4,12-diol (PubChem CID 11127251) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (4S,5R,12R)-spiro[4.7]dodecane-4,12-diol.
| Compound Name | (4S,5R,12R)-spiro[4.7]dodecane-4,12-diol |
|---|---|
| PubChem CID | 11127251 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (4S,5R,12R)-spiro[4.7]dodecane-4,12-diol |
| SMILES | O[C@@H]1CCCCCC[C@]12CCC[C@@H]2O |
| InChI | InChI=1S/C12H22O2/c13-10-6-3-1-2-4-8-12(10)9-5-7-11(12)14/h10-11,13-14H,1-9H2/t10-,11+,12+/m1/s1 |
| InChIKey | MSJZOOVSZKGBSI-WOPDTQHZSA-N |
| XLogP | 2.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |