C12H20O4 — CID 102353469
[(1S,2R,4S,5S,7S)-5-hydroxy-7-(hydroxymethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanyl] acetate (PubChem CID 102353469) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is [(1S,2R,4S,5S,7S)-5-hydroxy-7-(hydroxymethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanyl] acetate.
| Compound Name | [(1S,2R,4S,5S,7S)-5-hydroxy-7-(hydroxymethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanyl] acetate |
|---|---|
| PubChem CID | 102353469 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | [(1S,2R,4S,5S,7S)-5-hydroxy-7-(hydroxymethyl)-1,7-dimethyl-2-bicyclo[2.2.1]heptanyl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2[C@@H](O)C[C@@]1(C)[C@@]2(C)CO |
| InChI | InChI=1S/C12H20O4/c1-7(14)16-10-4-8-9(15)5-11(10,2)12(8,3)6-13/h8-10,13,15H,4-6H2,1-3H3/t8-,9+,10-,11-,12+/m1/s1 |
| InChIKey | PCSNCOVLXOOVTN-ROHXPCBUSA-N |
| XLogP | 0.71 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |