C16H30ClN — CID 171118726
[(2R)-2-[(1R)-1,4-dimethylcyclohex-3-en-1-yl]-6-methylhept-5-en-2-yl]azanium chloride (PubChem CID 171118726) has the molecular formula C16H30ClN and a molecular weight of 271.88 g/mol. Its IUPAC name is [(2R)-2-[(1R)-1,4-dimethylcyclohex-3-en-1-yl]-6-methylhept-5-en-2-yl]azanium chloride.
| Compound Name | [(2R)-2-[(1R)-1,4-dimethylcyclohex-3-en-1-yl]-6-methylhept-5-en-2-yl]azanium chloride |
|---|---|
| PubChem CID | 171118726 |
| Molecular Formula | C16H30ClN |
| Molecular Weight | 271.88 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | [(2R)-2-[(1R)-1,4-dimethylcyclohex-3-en-1-yl]-6-methylhept-5-en-2-yl]azanium chloride |
| SMILES | CC(C)=CCC[C@@](C)([NH3+])[C@@]1(C)CC=C(C)CC1.[Cl-] |
| InChI | InChI=1S/C16H29N.ClH/c1-13(2)7-6-10-16(5,17)15(4)11-8-14(3)9-12-15;/h7-8H,6,9-12,17H2,1-5H3;1H/t15-,16+;/m0./s1 |
| InChIKey | BGHCSPMKUMOKGG-IDVLALEDSA-N |
| XLogP | 0.87 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.88 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|