C15H25O+ — CID 123719125
6-methyl-2-(4-methylcyclohex-3-en-1-yl)hept-5-en-2-ol (PubChem CID 123719125) has the molecular formula C15H25O+ and a molecular weight of 221.36 g/mol. Its IUPAC name is 6-methyl-2-(4-methylcyclohex-3-en-1-yl)hept-5-en-2-ol.
| Compound Name | 6-methyl-2-(4-methylcyclohex-3-en-1-yl)hept-5-en-2-ol |
|---|---|
| PubChem CID | 123719125 |
| Molecular Formula | C15H25O+ |
| Molecular Weight | 221.36 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 6-methyl-2-(4-methylcyclohex-3-en-1-yl)hept-5-en-2-ol |
| SMILES | [CH2+]C(O)(CCC=C(C)C)C1CC=C(C)CC1 |
| InChI | InChI=1S/C15H25O/c1-12(2)6-5-11-15(4,16)14-9-7-13(3)8-10-14/h6-7,14,16H,4-5,8-11H2,1-3H3/q+1 |
| InChIKey | YRONIZFQZADKOC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|