C21H37N — CID 163157331
[6,10-dimethyl-2-(4-methylcyclohex-3-en-1-yl)undeca-5,9-dien-2-yl]-methanidylazanium (PubChem CID 163157331) has the molecular formula C21H37N and a molecular weight of 303.53 g/mol. Its IUPAC name is [6,10-dimethyl-2-(4-methylcyclohex-3-en-1-yl)undeca-5,9-dien-2-yl]-methanidylazanium.
| Compound Name | [6,10-dimethyl-2-(4-methylcyclohex-3-en-1-yl)undeca-5,9-dien-2-yl]-methanidylazanium |
|---|---|
| PubChem CID | 163157331 |
| Molecular Formula | C21H37N |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.29 |
| IUPAC Name | [6,10-dimethyl-2-(4-methylcyclohex-3-en-1-yl)undeca-5,9-dien-2-yl]-methanidylazanium |
| SMILES | [CH2-][NH2+]C(C)(CCC=C(C)CCC=C(C)C)C1CC=C(C)CC1 |
| InChI | InChI=1S/C21H37N/c1-17(2)9-7-10-18(3)11-8-16-21(5,22-6)20-14-12-19(4)13-15-20/h9,11-12,20H,6-8,10,13-16,22H2,1-5H3 |
| InChIKey | PQFGSTWOKZBGCB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|