C21H36N- — CID 163157332
[6,10-dimethyl-2-(4-methylcyclohex-3-en-1-yl)undeca-5,9-dien-2-yl]-methylazanide (PubChem CID 163157332) has the molecular formula C21H36N- and a molecular weight of 302.53 g/mol. Its IUPAC name is [6,10-dimethyl-2-(4-methylcyclohex-3-en-1-yl)undeca-5,9-dien-2-yl]-methylazanide.
| Compound Name | [6,10-dimethyl-2-(4-methylcyclohex-3-en-1-yl)undeca-5,9-dien-2-yl]-methylazanide |
|---|---|
| PubChem CID | 163157332 |
| Molecular Formula | C21H36N- |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.29 |
| IUPAC Name | [6,10-dimethyl-2-(4-methylcyclohex-3-en-1-yl)undeca-5,9-dien-2-yl]-methylazanide |
| SMILES | C[N-]C(C)(CCC=C(C)CCC=C(C)C)C1CC=C(C)CC1 |
| InChI | InChI=1S/C21H36N/c1-17(2)9-7-10-18(3)11-8-16-21(5,22-6)20-14-12-19(4)13-15-20/h9,11-12,20H,7-8,10,13-16H2,1-6H3/q-1 |
| InChIKey | RHRWJWYCVDWGLX-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|