C20H32O — CID 162905191
(1S,5Z,9R)-6-methyl-9-(6-methylhepta-1,5-dien-2-yl)-2-methylidenecyclodec-5-en-1-ol (PubChem CID 162905191) has the molecular formula C20H32O and a molecular weight of 288.47 g/mol. Its IUPAC name is (1S,5Z,9R)-6-methyl-9-(6-methylhepta-1,5-dien-2-yl)-2-methylidenecyclodec-5-en-1-ol.
| Compound Name | (1S,5Z,9R)-6-methyl-9-(6-methylhepta-1,5-dien-2-yl)-2-methylidenecyclodec-5-en-1-ol |
|---|---|
| PubChem CID | 162905191 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (1S,5Z,9R)-6-methyl-9-(6-methylhepta-1,5-dien-2-yl)-2-methylidenecyclodec-5-en-1-ol |
| SMILES | C=C(CCC=C(C)C)[C@@H]1CC/C(C)=C\CCC(=C)[C@@H](O)C1 |
| InChI | InChI=1S/C20H32O/c1-15(2)8-6-10-17(4)19-13-12-16(3)9-7-11-18(5)20(21)14-19/h8-9,19-21H,4-7,10-14H2,1-3H3/b16-9-/t19-,20+/m1/s1 |
| InChIKey | ZQWAPPQJKIEPOV-VTYIMSSISA-N |
| XLogP | 5.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|