C20H32O — CID 162979142
2-[(1R,3E,7E,11Z)-4,8,12-trimethylcyclotetradeca-3,7,11-trien-1-yl]prop-2-en-1-ol (PubChem CID 162979142) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is 2-[(1R,3E,7E,11Z)-4,8,12-trimethylcyclotetradeca-3,7,11-trien-1-yl]prop-2-en-1-ol.
| Compound Name | 2-[(1R,3E,7E,11Z)-4,8,12-trimethylcyclotetradeca-3,7,11-trien-1-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 162979142 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 2-[(1R,3E,7E,11Z)-4,8,12-trimethylcyclotetradeca-3,7,11-trien-1-yl]prop-2-en-1-ol |
| SMILES | C=C(CO)[C@H]1C/C=C(\C)CC/C=C(\C)CC/C=C(/C)CC1 |
| InChI | InChI=1S/C20H32O/c1-16-7-5-9-17(2)11-13-20(19(4)15-21)14-12-18(3)10-6-8-16/h7,10-11,20-21H,4-6,8-9,12-15H2,1-3H3/b16-7+,17-11+,18-10-/t20-/m0/s1 |
| InChIKey | MQZXPSOBCLRACA-QPRSWBNTSA-N |
| XLogP | 5.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|