C17H30 — CID 71334029
4-dec-1-en-2-yl-1-methylcyclohexene (PubChem CID 71334029) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is 4-dec-1-en-2-yl-1-methylcyclohexene.
| Compound Name | 4-dec-1-en-2-yl-1-methylcyclohexene |
|---|---|
| PubChem CID | 71334029 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 4-dec-1-en-2-yl-1-methylcyclohexene |
| SMILES | C=C(CCCCCCCC)C1CC=C(C)CC1 |
| InChI | InChI=1S/C17H30/c1-4-5-6-7-8-9-10-16(3)17-13-11-15(2)12-14-17/h11,17H,3-10,12-14H2,1-2H3 |
| InChIKey | FCEJPMCCKWAHHR-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|