C19H34 — CID 143245192
ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene (PubChem CID 143245192) has the molecular formula C19H34 and a molecular weight of 262.48 g/mol. Its IUPAC name is ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene.
| Compound Name | ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene |
|---|---|
| PubChem CID | 143245192 |
| Molecular Formula | C19H34 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.27 |
| IUPAC Name | ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene |
| SMILES | C=C(C)C1CC=C(C)CC1.CC.CC1CC=CCC1 |
| InChI | InChI=1S/C10H16.C7H12.C2H6/c1-8(2)10-6-4-9(3)5-7-10;1-7-5-3-2-4-6-7;1-2/h4,10H,1,5-7H2,2-3H3;2-3,7H,4-6H2,1H3;1-2H3 |
| InChIKey | ARQGQALIODXRFJ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|