About ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene
ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene (PubChem CID 143245192) has the molecular formula C19H34
and a molecular weight of 262.48 g/mol. Its IUPAC name is ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene.
Molecular Properties
| Compound Name | ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene |
| PubChem CID | 143245192 |
| Molecular Formula | C19H34 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.27 |
| IUPAC Name | ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene |
| SMILES | C=C(C)C1CC=C(C)CC1.CC.CC1CC=CCC1 |
| InChI | InChI=1S/C10H16.C7H12.C2H6/c1-8(2)10-6-4-9(3)5-7-10;1-7-5-3-2-4-6-7;1-2/h4,10H,1,5-7H2,2-3H3;2-3,7H,4-6H2,1H3;1-2H3 |
| InChIKey | ARQGQALIODXRFJ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene?
The IUPAC name of ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene (CID 143245192) is ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene.
What is the SMILES notation for ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene?
The canonical SMILES for ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene is C=C(C)C1CC=C(C)CC1.CC.CC1CC=CCC1.
What is the InChIKey of ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene?
The InChIKey is ARQGQALIODXRFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C7H12.C2H6/c1-8(2)10-6-4-9(3)5-7-10;1-7-5-3-2-4-6-7;1-2/h4,10H,1,5-7H2,2-3H3;2-3,7H,4-6H2,1H3;1-2H3.
What are the key properties of ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene?
ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene has a molecular weight of 262.48 g/mol, XLogP of 6.70, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methylcyclohexene;1-methyl-4-prop-1-en-2-ylcyclohexene is sourced from PubChem (CID 143245192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).