C10H16 — CID 10796799
(4R)-2-deuterio-1-methyl-4-prop-1-en-2-ylcyclohexene (PubChem CID 10796799) has the molecular formula C10H16 and a molecular weight of 137.24 g/mol. Its IUPAC name is (4R)-2-deuterio-1-methyl-4-prop-1-en-2-ylcyclohexene.
| Compound Name | (4R)-2-deuterio-1-methyl-4-prop-1-en-2-ylcyclohexene |
|---|---|
| PubChem CID | 10796799 |
| Molecular Formula | C10H16 |
| Molecular Weight | 137.24 g/mol |
| Exact Mass | 137.13 |
| IUPAC Name | (4R)-2-deuterio-1-methyl-4-prop-1-en-2-ylcyclohexene |
| SMILES | [2H]C1=C(C)CC[C@@H](C(=C)C)C1 |
| InChI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1/i4D |
| InChIKey | XMGQYMWWDOXHJM-RORIYYTMSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|