C13H20N2O2 — CID 131964076
imidazolidine-2,4-dione;1-methyl-4-prop-1-en-2-ylcyclohexene (PubChem CID 131964076) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is imidazolidine-2,4-dione;1-methyl-4-prop-1-en-2-ylcyclohexene.
| Compound Name | imidazolidine-2,4-dione;1-methyl-4-prop-1-en-2-ylcyclohexene |
|---|---|
| PubChem CID | 131964076 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | imidazolidine-2,4-dione;1-methyl-4-prop-1-en-2-ylcyclohexene |
| SMILES | C=C(C)C1CC=C(C)CC1.O=C1CNC(=O)N1 |
| InChI | InChI=1S/C10H16.C3H4N2O2/c1-8(2)10-6-4-9(3)5-7-10;6-2-1-4-3(7)5-2/h4,10H,1,5-7H2,2-3H3;1H2,(H2,4,5,6,7) |
| InChIKey | YLOLPIRXAUWUHJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|