C7H16N2O2 — CID 90911393
ethane;imidazolidine-2,4-dione (PubChem CID 90911393) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is ethane;imidazolidine-2,4-dione.
| Compound Name | ethane;imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90911393 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | ethane;imidazolidine-2,4-dione |
| SMILES | CC.CC.O=C1CNC(=O)N1 |
| InChI | InChI=1S/C3H4N2O2.2C2H6/c6-2-1-4-3(7)5-2;2*1-2/h1H2,(H2,4,5,6,7);2*1-2H3 |
| InChIKey | OCVXBGCYZRXZNS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|