C6H6N4O4 — CID 160657989
imidazole-2,4-dione;imidazolidine-2,4-dione (PubChem CID 160657989) has the molecular formula C6H6N4O4 and a molecular weight of 198.14 g/mol. Its IUPAC name is imidazole-2,4-dione;imidazolidine-2,4-dione.
| Compound Name | imidazole-2,4-dione;imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 160657989 |
| Molecular Formula | C6H6N4O4 |
| Molecular Weight | 198.14 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | imidazole-2,4-dione;imidazolidine-2,4-dione |
| SMILES | O=C1C=NC(=O)N1.O=C1CNC(=O)N1 |
| InChI | InChI=1S/C3H4N2O2.C3H2N2O2/c2*6-2-1-4-3(7)5-2/h1H2,(H2,4,5,6,7);1H,(H,5,6,7) |
| InChIKey | RLHLZUKAYBPPAJ-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.14 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|