C10H15N5O5 — CID 71356739
1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone (PubChem CID 71356739) has the molecular formula C10H15N5O5 and a molecular weight of 285.26 g/mol. Its IUPAC name is 1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone.
| Compound Name | 1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone |
|---|---|
| PubChem CID | 71356739 |
| Molecular Formula | C10H15N5O5 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1,4,7,10,13-pentazacyclopentadecane-2,5,8,11,14-pentone |
| SMILES | O=C1CNC(=O)CNC(=O)CNC(=O)CNC(=O)CN1 |
| InChI | InChI=1S/C10H15N5O5/c16-6-1-11-7(17)2-13-9(19)4-15-10(20)5-14-8(18)3-12-6/h1-5H2,(H,11,17)(H,12,16)(H,13,19)(H,14,18)(H,15,20) |
| InChIKey | HARBSVXRNFUELQ-UHFFFAOYSA-N |
| XLogP | -4.42 |
| TPSA | 145.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | -4.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |