C10H16N4O4 — CID 10198994
1,4-dimethyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone (PubChem CID 10198994) has the molecular formula C10H16N4O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is 1,4-dimethyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone.
| Compound Name | 1,4-dimethyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 10198994 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 1,4-dimethyl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
| SMILES | CN1CC(=O)NCC(=O)NCC(=O)N(C)CC1=O |
| InChI | InChI=1S/C10H16N4O4/c1-13-5-8(16)11-3-7(15)12-4-9(17)14(2)6-10(13)18/h3-6H2,1-2H3,(H,11,16)(H,12,15) |
| InChIKey | VQXNOVFPHWPHBE-UHFFFAOYSA-N |
| XLogP | -2.85 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |