C9H16N2O2 — CID 117026304
1-tert-butyl-4-methylpiperazine-2,5-dione (PubChem CID 117026304) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-tert-butyl-4-methylpiperazine-2,5-dione.
| Compound Name | 1-tert-butyl-4-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 117026304 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 1-tert-butyl-4-methylpiperazine-2,5-dione |
| SMILES | CN1CC(=O)N(C(C)(C)C)CC1=O |
| InChI | InChI=1S/C9H16N2O2/c1-9(2,3)11-6-7(12)10(4)5-8(11)13/h5-6H2,1-4H3 |
| InChIKey | UQMRNGZDFKMQPR-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |