C8H16N2O2Si — CID 138857492
1-methyl-4-trimethylsilylpiperazine-2,5-dione (PubChem CID 138857492) has the molecular formula C8H16N2O2Si and a molecular weight of 200.31 g/mol. Its IUPAC name is 1-methyl-4-trimethylsilylpiperazine-2,5-dione.
| Compound Name | 1-methyl-4-trimethylsilylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 138857492 |
| Molecular Formula | C8H16N2O2Si |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 1-methyl-4-trimethylsilylpiperazine-2,5-dione |
| SMILES | CN1CC(=O)N([Si](C)(C)C)CC1=O |
| InChI | InChI=1S/C8H16N2O2Si/c1-9-5-8(12)10(6-7(9)11)13(2,3)4/h5-6H2,1-4H3 |
| InChIKey | DVEOFMMAQMNRRJ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|