C7H11N3O3 — CID 139515723
1,3,5-trimethyl-1,3,5-triazepane-2,4,6-trione (PubChem CID 139515723) has the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. Its IUPAC name is 1,3,5-trimethyl-1,3,5-triazepane-2,4,6-trione.
| Compound Name | 1,3,5-trimethyl-1,3,5-triazepane-2,4,6-trione |
|---|---|
| PubChem CID | 139515723 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 1,3,5-trimethyl-1,3,5-triazepane-2,4,6-trione |
| SMILES | CN1CC(=O)N(C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C7H11N3O3/c1-8-4-5(11)9(2)7(13)10(3)6(8)12/h4H2,1-3H3 |
| InChIKey | RJTATQJXDQVDOX-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |