C11H18N4O3 — CID 159940640
1,3-dimethylimidazolidine-2,4-dione;1,3-dimethyl-4-methylideneimidazolidin-2-one (PubChem CID 159940640) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is 1,3-dimethylimidazolidine-2,4-dione;1,3-dimethyl-4-methylideneimidazolidin-2-one.
| Compound Name | 1,3-dimethylimidazolidine-2,4-dione;1,3-dimethyl-4-methylideneimidazolidin-2-one |
|---|---|
| PubChem CID | 159940640 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 1,3-dimethylimidazolidine-2,4-dione;1,3-dimethyl-4-methylideneimidazolidin-2-one |
| SMILES | C=C1CN(C)C(=O)N1C.CN1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C6H10N2O.C5H8N2O2/c1-5-4-7(2)6(9)8(5)3;1-6-3-4(8)7(2)5(6)9/h1,4H2,2-3H3;3H2,1-2H3 |
| InChIKey | OAVFROMLIMZDMG-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|