C7H12N2O3 — CID 145280798
3,5-dimethyl-1,3,5-oxadiazocane-4,6-dione (PubChem CID 145280798) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is 3,5-dimethyl-1,3,5-oxadiazocane-4,6-dione.
| Compound Name | 3,5-dimethyl-1,3,5-oxadiazocane-4,6-dione |
|---|---|
| PubChem CID | 145280798 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 3,5-dimethyl-1,3,5-oxadiazocane-4,6-dione |
| SMILES | CN1COCCC(=O)N(C)C1=O |
| InChI | InChI=1S/C7H12N2O3/c1-8-5-12-4-3-6(10)9(2)7(8)11/h3-5H2,1-2H3 |
| InChIKey | XKJDZQVQQNRQAP-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |