C7H14N2OS — CID 142135855
1,3-dimethyl-2-sulfanylideneimidazolidin-4-one;ethane (PubChem CID 142135855) has the molecular formula C7H14N2OS and a molecular weight of 174.27 g/mol. Its IUPAC name is 1,3-dimethyl-2-sulfanylideneimidazolidin-4-one;ethane.
| Compound Name | 1,3-dimethyl-2-sulfanylideneimidazolidin-4-one;ethane |
|---|---|
| PubChem CID | 142135855 |
| Molecular Formula | C7H14N2OS |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 1,3-dimethyl-2-sulfanylideneimidazolidin-4-one;ethane |
| SMILES | CC.CN1CC(=O)N(C)C1=S |
| InChI | InChI=1S/C5H8N2OS.C2H6/c1-6-3-4(8)7(2)5(6)9;1-2/h3H2,1-2H3;1-2H3 |
| InChIKey | SSFCFAGMBZJLFD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|