C4H5N2O3P — CID 130464004
1-methyl-3-phosphorosoimidazolidine-2,4-dione (PubChem CID 130464004) has the molecular formula C4H5N2O3P and a molecular weight of 160.07 g/mol. Its IUPAC name is 1-methyl-3-phosphorosoimidazolidine-2,4-dione.
| Compound Name | 1-methyl-3-phosphorosoimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 130464004 |
| Molecular Formula | C4H5N2O3P |
| Molecular Weight | 160.07 g/mol |
| Exact Mass | 160.00 |
| IUPAC Name | 1-methyl-3-phosphorosoimidazolidine-2,4-dione |
| SMILES | CN1CC(=O)N(P=O)C1=O |
| InChI | InChI=1S/C4H5N2O3P/c1-5-2-3(7)6(10-9)4(5)8/h2H2,1H3 |
| InChIKey | CVIKMEJKNSWEER-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.07 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|