C6H9FN2O2 — CID 127013693
3-(2-fluoroethyl)-1-methylimidazolidine-2,4-dione (PubChem CID 127013693) has the molecular formula C6H9FN2O2 and a molecular weight of 160.15 g/mol. Its IUPAC name is 3-(2-fluoroethyl)-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-(2-fluoroethyl)-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 127013693 |
| Molecular Formula | C6H9FN2O2 |
| Molecular Weight | 160.15 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 3-(2-fluoroethyl)-1-methylimidazolidine-2,4-dione |
| SMILES | CN1CC(=O)N(CCF)C1=O |
| InChI | InChI=1S/C6H9FN2O2/c1-8-4-5(10)9(3-2-7)6(8)11/h2-4H2,1H3 |
| InChIKey | GTHGSEJSEBKYOO-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.15 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|