C11H20N2O3 — CID 21027116
3-[2-(2,2-dimethylpropoxy)ethyl]-1-methylimidazolidine-2,4-dione (PubChem CID 21027116) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-[2-(2,2-dimethylpropoxy)ethyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(2,2-dimethylpropoxy)ethyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 21027116 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 3-[2-(2,2-dimethylpropoxy)ethyl]-1-methylimidazolidine-2,4-dione |
| SMILES | CN1CC(=O)N(CCOCC(C)(C)C)C1=O |
| InChI | InChI=1S/C11H20N2O3/c1-11(2,3)8-16-6-5-13-9(14)7-12(4)10(13)15/h5-8H2,1-4H3 |
| InChIKey | SEFKGAYVQRWRLC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|