C5H8ClN3O2 — CID 170447593
1-[chloro(methyl)amino]-3-methylimidazolidine-2,4-dione (PubChem CID 170447593) has the molecular formula C5H8ClN3O2 and a molecular weight of 177.59 g/mol. Its IUPAC name is 1-[chloro(methyl)amino]-3-methylimidazolidine-2,4-dione.
| Compound Name | 1-[chloro(methyl)amino]-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 170447593 |
| Molecular Formula | C5H8ClN3O2 |
| Molecular Weight | 177.59 g/mol |
| Exact Mass | 177.03 |
| IUPAC Name | 1-[chloro(methyl)amino]-3-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)CN(N(C)Cl)C1=O |
| InChI | InChI=1S/C5H8ClN3O2/c1-7-4(10)3-9(5(7)11)8(2)6/h3H2,1-2H3 |
| InChIKey | MAJVODNLOXNPAZ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.59 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|