C10H9ClN2O3 — CID 71357247
1-(4-chloro-2-hydroxyphenyl)-3-methylimidazolidine-2,4-dione (PubChem CID 71357247) has the molecular formula C10H9ClN2O3 and a molecular weight of 240.65 g/mol. Its IUPAC name is 1-(4-chloro-2-hydroxyphenyl)-3-methylimidazolidine-2,4-dione.
| Compound Name | 1-(4-chloro-2-hydroxyphenyl)-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71357247 |
| Molecular Formula | C10H9ClN2O3 |
| Molecular Weight | 240.65 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 1-(4-chloro-2-hydroxyphenyl)-3-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)CN(c2ccc(Cl)cc2O)C1=O |
| InChI | InChI=1S/C10H9ClN2O3/c1-12-9(15)5-13(10(12)16)7-3-2-6(11)4-8(7)14/h2-4,14H,5H2,1H3 |
| InChIKey | MYJYPMRIFZXDAD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.65 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|