C15H12Br2ClNO3 — CID 98277851
(1R,2S,6S,7R,8S,9R)-8,9-dibromo-4-(4-chloro-2-hydroxyphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 98277851) has the molecular formula C15H12Br2ClNO3 and a molecular weight of 449.53 g/mol. Its IUPAC name is (1R,2S,6S,7R,8S,9R)-8,9-dibromo-4-(4-chloro-2-hydroxyphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6S,7R,8S,9R)-8,9-dibromo-4-(4-chloro-2-hydroxyphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 98277851 |
| Molecular Formula | C15H12Br2ClNO3 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 446.89 |
| IUPAC Name | (1R,2S,6S,7R,8S,9R)-8,9-dibromo-4-(4-chloro-2-hydroxyphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H]3C[C@@H]([C@@H](Br)[C@H]3Br)[C@H]2C(=O)N1c1ccc(Cl)cc1O |
| InChI | InChI=1S/C15H12Br2ClNO3/c16-12-6-4-7(13(12)17)11-10(6)14(21)19(15(11)22)8-2-1-5(18)3-9(8)20/h1-3,6-7,10-13,20H,4H2/t6-,7-,10-,11-,12-,13+/m1/s1 |
| InChIKey | CPZWKABHQZNOQI-BOKPKCGUSA-N |
| XLogP | 3.33 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|