C17H17Br2NO2 — CID 23306772
(1R,2R,6R,7S,8R,9S)-8,9-dibromo-4-(2,4-dimethylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 23306772) has the molecular formula C17H17Br2NO2 and a molecular weight of 427.14 g/mol. Its IUPAC name is (1R,2R,6R,7S,8R,9S)-8,9-dibromo-4-(2,4-dimethylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2R,6R,7S,8R,9S)-8,9-dibromo-4-(2,4-dimethylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 23306772 |
| Molecular Formula | C17H17Br2NO2 |
| Molecular Weight | 427.14 g/mol |
| Exact Mass | 424.96 |
| IUPAC Name | (1R,2R,6R,7S,8R,9S)-8,9-dibromo-4-(2,4-dimethylphenyl)-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1ccc(N2C(=O)[C@H]3[C@@H]4C[C@@H]([C@H](Br)[C@@H]4Br)[C@@H]3C2=O)c(C)c1 |
| InChI | InChI=1S/C17H17Br2NO2/c1-7-3-4-11(8(2)5-7)20-16(21)12-9-6-10(13(12)17(20)22)15(19)14(9)18/h3-5,9-10,12-15H,6H2,1-2H3/t9-,10+,12-,13-,14+,15-/m0/s1 |
| InChIKey | QRUDAZXIICQKFD-XYVIHTCUSA-N |
| XLogP | 3.59 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.14 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|