C32H28Br4N2O6 — CID 5078006
8,9-dibromo-4-[4-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-methoxyphenyl]-2-methoxyphenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 5078006) has the molecular formula C32H28Br4N2O6 and a molecular weight of 856.20 g/mol. Its IUPAC name is 8,9-dibromo-4-[4-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-methoxyphenyl]-2-methoxyphenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 8,9-dibromo-4-[4-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-methoxyphenyl]-2-methoxyphenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 5078006 |
| Molecular Formula | C32H28Br4N2O6 |
| Molecular Weight | 856.20 g/mol |
| Exact Mass | 851.87 |
| IUPAC Name | 8,9-dibromo-4-[4-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-3-methoxyphenyl]-2-methoxyphenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | COc1cc(-c2ccc(N3C(=O)C4C5CC(C(Br)C5Br)C4C3=O)c(OC)c2)ccc1N1C(=O)C2C3CC(C(Br)C3Br)C2C1=O |
| InChI | InChI=1S/C32H28Br4N2O6/c1-43-19-7-11(3-5-17(19)37-29(39)21-13-9-14(22(21)30(37)40)26(34)25(13)33)12-4-6-18(20(8-12)44-2)38-31(41)23-15-10-16(24(23)32(38)42)28(36)27(15)35/h3-8,13-16,21-28H,9-10H2,1-2H3 |
| InChIKey | ZGTOLWFJKMXNQF-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.20 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|