C25H23Br2NO4 — CID 98279113
(1R,2S,6S,7R,8R,9S)-8,9-dibromo-4-[2-[2-(3,4-dimethylphenyl)-2-oxoethoxy]phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 98279113) has the molecular formula C25H23Br2NO4 and a molecular weight of 561.27 g/mol. Its IUPAC name is (1R,2S,6S,7R,8R,9S)-8,9-dibromo-4-[2-[2-(3,4-dimethylphenyl)-2-oxoethoxy]phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6S,7R,8R,9S)-8,9-dibromo-4-[2-[2-(3,4-dimethylphenyl)-2-oxoethoxy]phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 98279113 |
| Molecular Formula | C25H23Br2NO4 |
| Molecular Weight | 561.27 g/mol |
| Exact Mass | 559.00 |
| IUPAC Name | (1R,2S,6S,7R,8R,9S)-8,9-dibromo-4-[2-[2-(3,4-dimethylphenyl)-2-oxoethoxy]phenyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | Cc1ccc(C(=O)COc2ccccc2N2C(=O)[C@@H]3[C@H]4C[C@@H]([C@@H](Br)[C@H]4Br)[C@H]3C2=O)cc1C |
| InChI | InChI=1S/C25H23Br2NO4/c1-12-7-8-14(9-13(12)2)18(29)11-32-19-6-4-3-5-17(19)28-24(30)20-15-10-16(21(20)25(28)31)23(27)22(15)26/h3-9,15-16,20-23H,10-11H2,1-2H3/t15-,16-,20-,21-,22-,23+/m1/s1 |
| InChIKey | VLCXCQXIRBJFIV-CDEZGAEXSA-N |
| XLogP | 4.85 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.27 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|